C19H8F12O8S2 — CID 59652968
5-[1,1,1,3,3,3-hexafluoro-2-[4-(1,2,2-trifluoroethenoxy)-3-(trioxidanylsulfanyl)phenyl]propan-2-yl]-2-(1,2,2-trifluoroethenoxy)benzenesulfonic acid (PubChem CID 59652968) has the molecular formula C19H8F12O8S2 and a molecular weight of 656.38 g/mol. Its IUPAC name is 5-[1,1,1,3,3,3-hexafluoro-2-[4-(1,2,2-trifluoroethenoxy)-3-(trioxidanylsulfanyl)phenyl]propan-2-yl]-2-(1,2,2-trifluoroethenoxy)benzenesulfonic acid.
| Compound Name | 5-[1,1,1,3,3,3-hexafluoro-2-[4-(1,2,2-trifluoroethenoxy)-3-(trioxidanylsulfanyl)phenyl]propan-2-yl]-2-(1,2,2-trifluoroethenoxy)benzenesulfonic acid |
|---|---|
| PubChem CID | 59652968 |
| Molecular Formula | C19H8F12O8S2 |
| Molecular Weight | 656.38 g/mol |
| Exact Mass | 655.95 |
| IUPAC Name | 5-[1,1,1,3,3,3-hexafluoro-2-[4-(1,2,2-trifluoroethenoxy)-3-(trioxidanylsulfanyl)phenyl]propan-2-yl]-2-(1,2,2-trifluoroethenoxy)benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1cc(C(c2ccc(OC(F)=C(F)F)c(SOOO)c2)(C(F)(F)F)C(F)(F)F)ccc1OC(F)=C(F)F |
| InChI | InChI=1S/C19H8F12O8S2/c20-13(21)15(24)36-9-3-1-7(5-11(9)40-39-38-32)17(18(26,27)28,19(29,30)31)8-2-4-10(37-16(25)14(22)23)12(6-8)41(33,34)35/h1-6,32H,(H,33,34,35) |
| InChIKey | RECBECZPHRNVJN-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.38 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|