C13H29NO2Si — CID 59653325
(2S,3R,4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethyloxan-4-amine (PubChem CID 59653325) has the molecular formula C13H29NO2Si and a molecular weight of 259.47 g/mol. Its IUPAC name is (2S,3R,4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethyloxan-4-amine.
| Compound Name | (2S,3R,4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethyloxan-4-amine |
|---|---|
| PubChem CID | 59653325 |
| Molecular Formula | C13H29NO2Si |
| Molecular Weight | 259.47 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | (2S,3R,4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethyloxan-4-amine |
| SMILES | C[C@@H]1[C@H](N)C[C@@H](O[Si](C)(C)C(C)(C)C)O[C@H]1C |
| InChI | InChI=1S/C13H29NO2Si/c1-9-10(2)15-12(8-11(9)14)16-17(6,7)13(3,4)5/h9-12H,8,14H2,1-7H3/t9-,10-,11+,12+/m0/s1 |
| InChIKey | RFKVIOQHRBEDFH-NNYUYHANSA-N |
| XLogP | 3.11 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|