About 2,5-ditert-butyl-1,2,4-thiadiazol-2-ium
2,5-ditert-butyl-1,2,4-thiadiazol-2-ium (PubChem CID 59654204) has the molecular formula C10H19N2S+
and a molecular weight of 199.34 g/mol. Its IUPAC name is 2,5-ditert-butyl-1,2,4-thiadiazol-2-ium.
Molecular Properties
| Compound Name | 2,5-ditert-butyl-1,2,4-thiadiazol-2-ium |
| PubChem CID | 59654204 |
| Molecular Formula | C10H19N2S+ |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | 2,5-ditert-butyl-1,2,4-thiadiazol-2-ium |
| SMILES | CC(C)(C)c1nc[n+](C(C)(C)C)s1 |
| InChI | InChI=1S/C10H19N2S/c1-9(2,3)8-11-7-12(13-8)10(4,5)6/h7H,1-6H3/q+1 |
| InChIKey | FHFSLBJQDGCTEZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2,5-ditert-butyl-1,2,4-thiadiazol-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-ditert-butyl-1,2,4-thiadiazol-2-ium?
The IUPAC name of 2,5-ditert-butyl-1,2,4-thiadiazol-2-ium (CID 59654204) is 2,5-ditert-butyl-1,2,4-thiadiazol-2-ium.
What is the SMILES notation for 2,5-ditert-butyl-1,2,4-thiadiazol-2-ium?
The canonical SMILES for 2,5-ditert-butyl-1,2,4-thiadiazol-2-ium is CC(C)(C)c1nc[n+](C(C)(C)C)s1.
What is the InChIKey of 2,5-ditert-butyl-1,2,4-thiadiazol-2-ium?
The InChIKey is FHFSLBJQDGCTEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N2S/c1-9(2,3)8-11-7-12(13-8)10(4,5)6/h7H,1-6H3/q+1.
What are the key properties of 2,5-ditert-butyl-1,2,4-thiadiazol-2-ium?
2,5-ditert-butyl-1,2,4-thiadiazol-2-ium has a molecular weight of 199.34 g/mol, XLogP of 2.48, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-ditert-butyl-1,2,4-thiadiazol-2-ium is sourced from PubChem (CID 59654204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).