C32H28Cl2FN3O2 — CID 59654582
4-(2,6-dichlorophenyl)-N-[(1R,2R)-6-[1-[(4-fluorophenyl)methyl-methylamino]ethylideneamino]-2-hydroxy-2,3-dihydro-1H-inden-1-yl]benzamide (PubChem CID 59654582) has the molecular formula C32H28Cl2FN3O2 and a molecular weight of 576.50 g/mol. Its IUPAC name is 4-(2,6-dichlorophenyl)-N-[(1R,2R)-6-[1-[(4-fluorophenyl)methyl-methylamino]ethylideneamino]-2-hydroxy-2,3-dihydro-1H-inden-1-yl]benzamide.
| Compound Name | 4-(2,6-dichlorophenyl)-N-[(1R,2R)-6-[1-[(4-fluorophenyl)methyl-methylamino]ethylideneamino]-2-hydroxy-2,3-dihydro-1H-inden-1-yl]benzamide |
|---|---|
| PubChem CID | 59654582 |
| Molecular Formula | C32H28Cl2FN3O2 |
| Molecular Weight | 576.50 g/mol |
| Exact Mass | 575.15 |
| IUPAC Name | 4-(2,6-dichlorophenyl)-N-[(1R,2R)-6-[1-[(4-fluorophenyl)methyl-methylamino]ethylideneamino]-2-hydroxy-2,3-dihydro-1H-inden-1-yl]benzamide |
| SMILES | C/C(=N\c1ccc2c(c1)[C@@H](NC(=O)c1ccc(-c3c(Cl)cccc3Cl)cc1)[C@H](O)C2)N(C)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C32H28Cl2FN3O2/c1-19(38(2)18-20-6-13-24(35)14-7-20)36-25-15-12-23-16-29(39)31(26(23)17-25)37-32(40)22-10-8-21(9-11-22)30-27(33)4-3-5-28(30)34/h3-15,17,29,31,39H,16,18H2,1-2H3,(H,37,40)/b36-19+/t29-,31-/m1/s1 |
| InChIKey | MZNJNCXNVXZZJJ-XJBJVIFUSA-N |
| XLogP | 7.37 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.50 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|