C13H14N2O — CID 59654896
(1R,12S)-3,11-dimethyl-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-trien-7-one (PubChem CID 59654896) has the molecular formula C13H14N2O and a molecular weight of 214.27 g/mol. Its IUPAC name is (1R,12S)-3,11-dimethyl-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-trien-7-one.
| Compound Name | (1R,12S)-3,11-dimethyl-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-trien-7-one |
|---|---|
| PubChem CID | 59654896 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | (1R,12S)-3,11-dimethyl-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-trien-7-one |
| SMILES | Cc1c[nH]c2c1[C@@]13C[C@@H]1C(C)NC3=CC2=O |
| InChI | InChI=1S/C13H14N2O/c1-6-5-14-12-9(16)3-10-13(11(6)12)4-8(13)7(2)15-10/h3,5,7-8,14-15H,4H2,1-2H3/t7?,8-,13+/m1/s1 |
| InChIKey | IHPVXJWASPGPKU-SGYUCTRHSA-N |
| XLogP | 1.65 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |