C23H26N4O2 — CID 59655268
3-methyl-N-[1-(6-methyl-1H-benzimidazol-2-yl)ethyl]-4-(pyrrolidine-1-carbonyl)benzamide (PubChem CID 59655268) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 3-methyl-N-[1-(6-methyl-1H-benzimidazol-2-yl)ethyl]-4-(pyrrolidine-1-carbonyl)benzamide.
| Compound Name | 3-methyl-N-[1-(6-methyl-1H-benzimidazol-2-yl)ethyl]-4-(pyrrolidine-1-carbonyl)benzamide |
|---|---|
| PubChem CID | 59655268 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 3-methyl-N-[1-(6-methyl-1H-benzimidazol-2-yl)ethyl]-4-(pyrrolidine-1-carbonyl)benzamide |
| SMILES | Cc1ccc2nc(C(C)NC(=O)c3ccc(C(=O)N4CCCC4)c(C)c3)[nH]c2c1 |
| InChI | InChI=1S/C23H26N4O2/c1-14-6-9-19-20(12-14)26-21(25-19)16(3)24-22(28)17-7-8-18(15(2)13-17)23(29)27-10-4-5-11-27/h6-9,12-13,16H,4-5,10-11H2,1-3H3,(H,24,28)(H,25,26) |
| InChIKey | APQYKZLFOUZRCN-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |