C23H22N2O — CID 59655379
2-[(4S,5R)-4,5-diphenyl-4,5-dihydro-1H-imidazol-2-yl]-1-phenylethanol (PubChem CID 59655379) has the molecular formula C23H22N2O and a molecular weight of 342.44 g/mol. Its IUPAC name is 2-[(4S,5R)-4,5-diphenyl-4,5-dihydro-1H-imidazol-2-yl]-1-phenylethanol.
| Compound Name | 2-[(4S,5R)-4,5-diphenyl-4,5-dihydro-1H-imidazol-2-yl]-1-phenylethanol |
|---|---|
| PubChem CID | 59655379 |
| Molecular Formula | C23H22N2O |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 2-[(4S,5R)-4,5-diphenyl-4,5-dihydro-1H-imidazol-2-yl]-1-phenylethanol |
| SMILES | OC(CC1=N[C@@H](c2ccccc2)[C@@H](c2ccccc2)N1)c1ccccc1 |
| InChI | InChI=1S/C23H22N2O/c26-20(17-10-4-1-5-11-17)16-21-24-22(18-12-6-2-7-13-18)23(25-21)19-14-8-3-9-15-19/h1-15,20,22-23,26H,16H2,(H,24,25)/t20?,22-,23+ |
| InChIKey | CWQCCNVQWKIONV-BRTIRZTQSA-N |
| XLogP | 4.59 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |