C18H27N3 — CID 59656064
3-(3,5-dimethyl-1-adamantyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 59656064) has the molecular formula C18H27N3 and a molecular weight of 285.44 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1-adamantyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3-(3,5-dimethyl-1-adamantyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 59656064 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | 3-(3,5-dimethyl-1-adamantyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | CC12CC3CC(C)(C1)CC(c1nnc4n1CCCC4)(C3)C2 |
| InChI | InChI=1S/C18H27N3/c1-16-7-13-8-17(2,10-16)12-18(9-13,11-16)15-20-19-14-5-3-4-6-21(14)15/h13H,3-12H2,1-2H3 |
| InChIKey | WNHABYCXRIPFCZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |