C22H22O5 — CID 59656246
(3S)-3-(3,4,5-trimethoxyphenyl)-2,3-dihydro-1H-benzo[f]chromen-1-ol (PubChem CID 59656246) has the molecular formula C22H22O5 and a molecular weight of 366.41 g/mol. Its IUPAC name is (3S)-3-(3,4,5-trimethoxyphenyl)-2,3-dihydro-1H-benzo[f]chromen-1-ol.
| Compound Name | (3S)-3-(3,4,5-trimethoxyphenyl)-2,3-dihydro-1H-benzo[f]chromen-1-ol |
|---|---|
| PubChem CID | 59656246 |
| Molecular Formula | C22H22O5 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | (3S)-3-(3,4,5-trimethoxyphenyl)-2,3-dihydro-1H-benzo[f]chromen-1-ol |
| SMILES | COc1cc([C@@H]2CC(O)c3c(ccc4ccccc34)O2)cc(OC)c1OC |
| InChI | InChI=1S/C22H22O5/c1-24-19-10-14(11-20(25-2)22(19)26-3)18-12-16(23)21-15-7-5-4-6-13(15)8-9-17(21)27-18/h4-11,16,18,23H,12H2,1-3H3/t16?,18-/m0/s1 |
| InChIKey | VZTRGMXCWAMDQO-DAFXYXGESA-N |
| XLogP | 4.42 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |