C13H20O2 — CID 596569
4-hydroxy-1,4,8,8-tetramethylbicyclo[3.3.1]non-2-en-9-one (PubChem CID 596569) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 4-hydroxy-1,4,8,8-tetramethylbicyclo[3.3.1]non-2-en-9-one.
| Compound Name | 4-hydroxy-1,4,8,8-tetramethylbicyclo[3.3.1]non-2-en-9-one |
|---|---|
| PubChem CID | 596569 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 4-hydroxy-1,4,8,8-tetramethylbicyclo[3.3.1]non-2-en-9-one |
| SMILES | CC1(O)C=CC2(C)C(=O)C1CCC2(C)C |
| InChI | InChI=1S/C13H20O2/c1-11(2)6-5-9-10(14)12(11,3)7-8-13(9,4)15/h7-9,15H,5-6H2,1-4H3 |
| InChIKey | XCPQVJWTRPNZJC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|