C19H14IrN3O2- — CID 59657020
iridium;isoquinoline-3-carboxylic acid;1-phenylpyrazole (PubChem CID 59657020) has the molecular formula C19H14IrN3O2- and a molecular weight of 508.56 g/mol. Its IUPAC name is iridium;isoquinoline-3-carboxylic acid;1-phenylpyrazole.
| Compound Name | iridium;isoquinoline-3-carboxylic acid;1-phenylpyrazole |
|---|---|
| PubChem CID | 59657020 |
| Molecular Formula | C19H14IrN3O2- |
| Molecular Weight | 508.56 g/mol |
| Exact Mass | 509.07 |
| IUPAC Name | iridium;isoquinoline-3-carboxylic acid;1-phenylpyrazole |
| SMILES | O=C(O)c1cc2ccccc2cn1.[Ir].[c-]1ccccc1-n1cccn1 |
| InChI | InChI=1S/C10H7NO2.C9H7N2.Ir/c12-10(13)9-5-7-3-1-2-4-8(7)6-11-9;1-2-5-9(6-3-1)11-8-4-7-10-11;/h1-6H,(H,12,13);1-5,7-8H;/q;-1; |
| InChIKey | RFHLMBXNHWKANF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.56 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|