About 2-(Dipropylamino)ethyl 2,2-dimethylbutanoate
2-(Dipropylamino)ethyl 2,2-dimethylbutanoate (PubChem CID 59657194) has the molecular formula C14H29NO2
and a molecular weight of 243.39 g/mol. Its IUPAC name is 2-(dipropylamino)ethyl 2,2-dimethylbutanoate.
Molecular Properties
| Compound Name | 2-(Dipropylamino)ethyl 2,2-dimethylbutanoate |
| PubChem CID | 59657194 |
| Molecular Formula | C14H29NO2 |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.22 |
| IUPAC Name | 2-(dipropylamino)ethyl 2,2-dimethylbutanoate |
| SMILES | CCCN(CCC)CCOC(=O)C(C)(C)CC |
| InChI | InChI=1S/C14H29NO2/c1-6-9-15(10-7-2)11-12-17-13(16)14(4,5)8-3/h6-12H2,1-5H3 |
| InChIKey | GQBOMFVTFGSZCB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 29.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | 208 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(Dipropylamino)ethyl 2,2-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(Dipropylamino)ethyl 2,2-dimethylbutanoate?
The IUPAC name of 2-(Dipropylamino)ethyl 2,2-dimethylbutanoate (CID 59657194) is 2-(dipropylamino)ethyl 2,2-dimethylbutanoate.
What is the SMILES notation for 2-(Dipropylamino)ethyl 2,2-dimethylbutanoate?
The canonical SMILES for 2-(Dipropylamino)ethyl 2,2-dimethylbutanoate is CCCN(CCC)CCOC(=O)C(C)(C)CC.
What is the InChIKey of 2-(Dipropylamino)ethyl 2,2-dimethylbutanoate?
The InChIKey is GQBOMFVTFGSZCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO2/c1-6-9-15(10-7-2)11-12-17-13(16)14(4,5)8-3/h6-12H2,1-5H3.
What are the key properties of 2-(Dipropylamino)ethyl 2,2-dimethylbutanoate?
2-(Dipropylamino)ethyl 2,2-dimethylbutanoate has a molecular weight of 243.39 g/mol, XLogP of 3.70, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(Dipropylamino)ethyl 2,2-dimethylbutanoate is sourced from PubChem (CID 59657194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).