C22H42O6P2S — CID 59657350
(3R,4S,5R,6R,9R,10S,11S,12R,14R)-14-ethyl-3,5,6,7,7,9,11-heptamethyl-10,12-bis(phosphanyloxy)-4-sulfanyloxy-oxacyclotetradecane-2,13-dione (PubChem CID 59657350) has the molecular formula C22H42O6P2S and a molecular weight of 496.59 g/mol. Its IUPAC name is (3R,4S,5R,6R,9R,10S,11S,12R,14R)-14-ethyl-3,5,6,7,7,9,11-heptamethyl-10,12-bis(phosphanyloxy)-4-sulfanyloxy-oxacyclotetradecane-2,13-dione.
| Compound Name | (3R,4S,5R,6R,9R,10S,11S,12R,14R)-14-ethyl-3,5,6,7,7,9,11-heptamethyl-10,12-bis(phosphanyloxy)-4-sulfanyloxy-oxacyclotetradecane-2,13-dione |
|---|---|
| PubChem CID | 59657350 |
| Molecular Formula | C22H42O6P2S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | (3R,4S,5R,6R,9R,10S,11S,12R,14R)-14-ethyl-3,5,6,7,7,9,11-heptamethyl-10,12-bis(phosphanyloxy)-4-sulfanyloxy-oxacyclotetradecane-2,13-dione |
| SMILES | CC[C@H]1OC(=O)[C@H](C)[C@@H](OS)[C@H](C)[C@@H](C)C(C)(C)C[C@@H](C)[C@H](OP)[C@H](C)[C@@H](OP)C1=O |
| InChI | InChI=1S/C22H42O6P2S/c1-9-16-17(23)20(27-30)13(4)18(26-29)11(2)10-22(7,8)15(6)12(3)19(28-31)14(5)21(24)25-16/h11-16,18-20,31H,9-10,29-30H2,1-8H3/t11-,12-,13+,14-,15-,16-,18+,19+,20-/m1/s1 |
| InChIKey | UDUHUPZYSNKYEW-JIHJFMGJSA-N |
| XLogP | 5.07 |
| TPSA | 71.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|