About (4R)-4-butyl-3,8-dimethyl-1-oxa-3,8-diazaspiro[4.5]decan-2-one
(4R)-4-butyl-3,8-dimethyl-1-oxa-3,8-diazaspiro[4.5]decan-2-one (PubChem CID 59657457) has the molecular formula C13H24N2O2
and a molecular weight of 240.35 g/mol. Its IUPAC name is (4R)-4-butyl-3,8-dimethyl-1-oxa-3,8-diazaspiro[4.5]decan-2-one.
Molecular Properties
| Compound Name | (4R)-4-butyl-3,8-dimethyl-1-oxa-3,8-diazaspiro[4.5]decan-2-one |
| PubChem CID | 59657457 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | (4R)-4-butyl-3,8-dimethyl-1-oxa-3,8-diazaspiro[4.5]decan-2-one |
| SMILES | CCCC[C@H]1N(C)C(=O)OC12CCN(C)CC2 |
| InChI | InChI=1S/C13H24N2O2/c1-4-5-6-11-13(17-12(16)15(11)3)7-9-14(2)10-8-13/h11H,4-10H2,1-3H3/t11-/m1/s1 |
| InChIKey | PXLNCXSTTNOXRT-LLVKDONJSA-N |
| XLogP | 2.09 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-4-butyl-3,8-dimethyl-1-oxa-3,8-diazaspiro[4.5]decan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-butyl-3,8-dimethyl-1-oxa-3,8-diazaspiro[4.5]decan-2-one?
The IUPAC name of (4R)-4-butyl-3,8-dimethyl-1-oxa-3,8-diazaspiro[4.5]decan-2-one (CID 59657457) is (4R)-4-butyl-3,8-dimethyl-1-oxa-3,8-diazaspiro[4.5]decan-2-one.
What is the SMILES notation for (4R)-4-butyl-3,8-dimethyl-1-oxa-3,8-diazaspiro[4.5]decan-2-one?
The canonical SMILES for (4R)-4-butyl-3,8-dimethyl-1-oxa-3,8-diazaspiro[4.5]decan-2-one is CCCC[C@H]1N(C)C(=O)OC12CCN(C)CC2.
What is the InChIKey of (4R)-4-butyl-3,8-dimethyl-1-oxa-3,8-diazaspiro[4.5]decan-2-one?
The InChIKey is PXLNCXSTTNOXRT-LLVKDONJSA-N. The full InChI is InChI=1S/C13H24N2O2/c1-4-5-6-11-13(17-12(16)15(11)3)7-9-14(2)10-8-13/h11H,4-10H2,1-3H3/t11-/m1/s1.
What are the key properties of (4R)-4-butyl-3,8-dimethyl-1-oxa-3,8-diazaspiro[4.5]decan-2-one?
(4R)-4-butyl-3,8-dimethyl-1-oxa-3,8-diazaspiro[4.5]decan-2-one has a molecular weight of 240.35 g/mol, XLogP of 2.09, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-butyl-3,8-dimethyl-1-oxa-3,8-diazaspiro[4.5]decan-2-one is sourced from PubChem (CID 59657457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).