C20H25FN2O — CID 59658171
N-[(1R,3S)-5-fluoro-2-adamantyl]-3,4-dihydro-2H-quinoline-1-carboxamide (PubChem CID 59658171) has the molecular formula C20H25FN2O and a molecular weight of 328.43 g/mol. Its IUPAC name is N-[(1R,3S)-5-fluoro-2-adamantyl]-3,4-dihydro-2H-quinoline-1-carboxamide.
| Compound Name | N-[(1R,3S)-5-fluoro-2-adamantyl]-3,4-dihydro-2H-quinoline-1-carboxamide |
|---|---|
| PubChem CID | 59658171 |
| Molecular Formula | C20H25FN2O |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | N-[(1R,3S)-5-fluoro-2-adamantyl]-3,4-dihydro-2H-quinoline-1-carboxamide |
| SMILES | O=C(NC1[C@@H]2CC3C[C@H]1CC(F)(C3)C2)N1CCCc2ccccc21 |
| InChI | InChI=1S/C20H25FN2O/c21-20-10-13-8-15(11-20)18(16(9-13)12-20)22-19(24)23-7-3-5-14-4-1-2-6-17(14)23/h1-2,4,6,13,15-16,18H,3,5,7-12H2,(H,22,24)/t13?,15-,16+,18?,20? |
| InChIKey | FEWYEGPCHHKGPU-LYLPNMKGSA-N |
| XLogP | 4.07 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |