C22H30FNO2 — CID 59658186
N-[(1R,3R)-5-fluoro-2-adamantyl]-2-(3-methoxy-5-methylphenyl)-2-methylpropanamide (PubChem CID 59658186) has the molecular formula C22H30FNO2 and a molecular weight of 359.49 g/mol. Its IUPAC name is N-[(1R,3R)-5-fluoro-2-adamantyl]-2-(3-methoxy-5-methylphenyl)-2-methylpropanamide.
| Compound Name | N-[(1R,3R)-5-fluoro-2-adamantyl]-2-(3-methoxy-5-methylphenyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 59658186 |
| Molecular Formula | C22H30FNO2 |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | N-[(1R,3R)-5-fluoro-2-adamantyl]-2-(3-methoxy-5-methylphenyl)-2-methylpropanamide |
| SMILES | COc1cc(C)cc(C(C)(C)C(=O)NC2[C@@H]3CC4C[C@@H]2CC(F)(C4)C3)c1 |
| InChI | InChI=1S/C22H30FNO2/c1-13-5-17(9-18(6-13)26-4)21(2,3)20(25)24-19-15-7-14-8-16(19)12-22(23,10-14)11-15/h5-6,9,14-16,19H,7-8,10-12H2,1-4H3,(H,24,25)/t14?,15-,16-,19?,22?/m1/s1 |
| InChIKey | KUZAWLYGRZOPEL-VGJXUBOBSA-N |
| XLogP | 4.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |