About 6-bromo-1,2,3,4-tetrafluoronaphthalene
6-bromo-1,2,3,4-tetrafluoronaphthalene (PubChem CID 59658286) has the molecular formula C10H3BrF4
and a molecular weight of 279.03 g/mol. Its IUPAC name is 6-bromo-1,2,3,4-tetrafluoronaphthalene.
Molecular Properties
| Compound Name | 6-bromo-1,2,3,4-tetrafluoronaphthalene |
| PubChem CID | 59658286 |
| Molecular Formula | C10H3BrF4 |
| Molecular Weight | 279.03 g/mol |
| Exact Mass | 277.94 |
| IUPAC Name | 6-bromo-1,2,3,4-tetrafluoronaphthalene |
| SMILES | Fc1c(F)c(F)c2cc(Br)ccc2c1F |
| InChI | InChI=1S/C10H3BrF4/c11-4-1-2-5-6(3-4)8(13)10(15)9(14)7(5)12/h1-3H |
| InChIKey | VDAAVUNAWBIYII-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.03 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-1,2,3,4-tetrafluoronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1,2,3,4-tetrafluoronaphthalene?
The IUPAC name of 6-bromo-1,2,3,4-tetrafluoronaphthalene (CID 59658286) is 6-bromo-1,2,3,4-tetrafluoronaphthalene.
What is the SMILES notation for 6-bromo-1,2,3,4-tetrafluoronaphthalene?
The canonical SMILES for 6-bromo-1,2,3,4-tetrafluoronaphthalene is Fc1c(F)c(F)c2cc(Br)ccc2c1F.
What is the InChIKey of 6-bromo-1,2,3,4-tetrafluoronaphthalene?
The InChIKey is VDAAVUNAWBIYII-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H3BrF4/c11-4-1-2-5-6(3-4)8(13)10(15)9(14)7(5)12/h1-3H.
What are the key properties of 6-bromo-1,2,3,4-tetrafluoronaphthalene?
6-bromo-1,2,3,4-tetrafluoronaphthalene has a molecular weight of 279.03 g/mol, XLogP of 4.16, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1,2,3,4-tetrafluoronaphthalene is sourced from PubChem (CID 59658286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).