C18H24N2O6 — CID 59658349
methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(2-oxopropanoylamino)phenyl]propanoate (PubChem CID 59658349) has the molecular formula C18H24N2O6 and a molecular weight of 364.40 g/mol. Its IUPAC name is methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(2-oxopropanoylamino)phenyl]propanoate.
| Compound Name | methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(2-oxopropanoylamino)phenyl]propanoate |
|---|---|
| PubChem CID | 59658349 |
| Molecular Formula | C18H24N2O6 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(2-oxopropanoylamino)phenyl]propanoate |
| SMILES | COC(=O)C(Cc1ccc(NC(=O)C(C)=O)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H24N2O6/c1-11(21)15(22)19-13-8-6-12(7-9-13)10-14(16(23)25-5)20-17(24)26-18(2,3)4/h6-9,14H,10H2,1-5H3,(H,19,22)(H,20,24) |
| InChIKey | CCDYHZOPFWYZKA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|