About (2S)-2-azaniumyl-3-(2,3-dioxo-1H-indol-5-yl)propanoate
(2S)-2-azaniumyl-3-(2,3-dioxo-1H-indol-5-yl)propanoate (PubChem CID 59658407) has the molecular formula C11H10N2O4
and a molecular weight of 234.21 g/mol. Its IUPAC name is (2S)-2-azaniumyl-3-(2,3-dioxo-1H-indol-5-yl)propanoate.
Molecular Properties
| Compound Name | (2S)-2-azaniumyl-3-(2,3-dioxo-1H-indol-5-yl)propanoate |
| PubChem CID | 59658407 |
| Molecular Formula | C11H10N2O4 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | (2S)-2-azaniumyl-3-(2,3-dioxo-1H-indol-5-yl)propanoate |
| SMILES | [NH3+][C@@H](Cc1ccc2c(c1)C(=O)C(=O)N2)C(=O)[O-] |
| InChI | InChI=1S/C11H10N2O4/c12-7(11(16)17)4-5-1-2-8-6(3-5)9(14)10(15)13-8/h1-3,7H,4,12H2,(H,16,17)(H,13,14,15)/t7-/m0/s1 |
| InChIKey | GYVRRFDJGZQPPK-ZETCQYMHSA-N |
| XLogP | -2.28 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-azaniumyl-3-(2,3-dioxo-1H-indol-5-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-azaniumyl-3-(2,3-dioxo-1H-indol-5-yl)propanoate?
The IUPAC name of (2S)-2-azaniumyl-3-(2,3-dioxo-1H-indol-5-yl)propanoate (CID 59658407) is (2S)-2-azaniumyl-3-(2,3-dioxo-1H-indol-5-yl)propanoate.
What is the SMILES notation for (2S)-2-azaniumyl-3-(2,3-dioxo-1H-indol-5-yl)propanoate?
The canonical SMILES for (2S)-2-azaniumyl-3-(2,3-dioxo-1H-indol-5-yl)propanoate is [NH3+][C@@H](Cc1ccc2c(c1)C(=O)C(=O)N2)C(=O)[O-].
What is the InChIKey of (2S)-2-azaniumyl-3-(2,3-dioxo-1H-indol-5-yl)propanoate?
The InChIKey is GYVRRFDJGZQPPK-ZETCQYMHSA-N. The full InChI is InChI=1S/C11H10N2O4/c12-7(11(16)17)4-5-1-2-8-6(3-5)9(14)10(15)13-8/h1-3,7H,4,12H2,(H,16,17)(H,13,14,15)/t7-/m0/s1.
What are the key properties of (2S)-2-azaniumyl-3-(2,3-dioxo-1H-indol-5-yl)propanoate?
(2S)-2-azaniumyl-3-(2,3-dioxo-1H-indol-5-yl)propanoate has a molecular weight of 234.21 g/mol, XLogP of -2.28, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-azaniumyl-3-(2,3-dioxo-1H-indol-5-yl)propanoate is sourced from PubChem (CID 59658407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).