About [2,5-bis(ethenyl)-4-(hydroxymethyl)oxolan-3-yl]methanol
[2,5-bis(ethenyl)-4-(hydroxymethyl)oxolan-3-yl]methanol (PubChem CID 59658486) has the molecular formula C10H16O3
and a molecular weight of 184.23 g/mol. Its IUPAC name is [2,5-bis(ethenyl)-4-(hydroxymethyl)oxolan-3-yl]methanol.
Molecular Properties
| Compound Name | [2,5-bis(ethenyl)-4-(hydroxymethyl)oxolan-3-yl]methanol |
| PubChem CID | 59658486 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | [2,5-bis(ethenyl)-4-(hydroxymethyl)oxolan-3-yl]methanol |
| SMILES | C=CC1OC(C=C)C(CO)C1CO |
| InChI | InChI=1S/C10H16O3/c1-3-9-7(5-11)8(6-12)10(4-2)13-9/h3-4,7-12H,1-2,5-6H2 |
| InChIKey | GEZHPDDCKWHIFZ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2,5-bis(ethenyl)-4-(hydroxymethyl)oxolan-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,5-bis(ethenyl)-4-(hydroxymethyl)oxolan-3-yl]methanol?
The IUPAC name of [2,5-bis(ethenyl)-4-(hydroxymethyl)oxolan-3-yl]methanol (CID 59658486) is [2,5-bis(ethenyl)-4-(hydroxymethyl)oxolan-3-yl]methanol.
What is the SMILES notation for [2,5-bis(ethenyl)-4-(hydroxymethyl)oxolan-3-yl]methanol?
The canonical SMILES for [2,5-bis(ethenyl)-4-(hydroxymethyl)oxolan-3-yl]methanol is C=CC1OC(C=C)C(CO)C1CO.
What is the InChIKey of [2,5-bis(ethenyl)-4-(hydroxymethyl)oxolan-3-yl]methanol?
The InChIKey is GEZHPDDCKWHIFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O3/c1-3-9-7(5-11)8(6-12)10(4-2)13-9/h3-4,7-12H,1-2,5-6H2.
What are the key properties of [2,5-bis(ethenyl)-4-(hydroxymethyl)oxolan-3-yl]methanol?
[2,5-bis(ethenyl)-4-(hydroxymethyl)oxolan-3-yl]methanol has a molecular weight of 184.23 g/mol, XLogP of 0.34, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2,5-bis(ethenyl)-4-(hydroxymethyl)oxolan-3-yl]methanol is sourced from PubChem (CID 59658486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).