C22H25F11O2 — CID 59658592
[3,3,4,4,5,6,6,6-octafluoro-5-(trifluoromethyl)hexyl] 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate (PubChem CID 59658592) has the molecular formula C22H25F11O2 and a molecular weight of 530.42 g/mol. Its IUPAC name is [3,3,4,4,5,6,6,6-octafluoro-5-(trifluoromethyl)hexyl] 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate.
| Compound Name | [3,3,4,4,5,6,6,6-octafluoro-5-(trifluoromethyl)hexyl] 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
|---|---|
| PubChem CID | 59658592 |
| Molecular Formula | C22H25F11O2 |
| Molecular Weight | 530.42 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | [3,3,4,4,5,6,6,6-octafluoro-5-(trifluoromethyl)hexyl] 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
| SMILES | CC1C(C)C2CC1C1C3CC(C(=O)OCCC(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F)C(C3)C21 |
| InChI | InChI=1S/C22H25F11O2/c1-8-9(2)12-7-11(8)15-10-5-13(16(12)15)14(6-10)17(34)35-4-3-18(23,24)20(26,27)19(25,21(28,29)30)22(31,32)33/h8-16H,3-7H2,1-2H3 |
| InChIKey | FWJAORLRIGARFC-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.42 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|