C32H33FN6O5 — CID 59658855
2-[3-[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-[(E)-2-phenylethenyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]propyl]-3-fluorobenzoic acid (PubChem CID 59658855) has the molecular formula C32H33FN6O5 and a molecular weight of 600.65 g/mol. Its IUPAC name is 2-[3-[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-[(E)-2-phenylethenyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]propyl]-3-fluorobenzoic acid.
| Compound Name | 2-[3-[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-[(E)-2-phenylethenyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]propyl]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 59658855 |
| Molecular Formula | C32H33FN6O5 |
| Molecular Weight | 600.65 g/mol |
| Exact Mass | 600.25 |
| IUPAC Name | 2-[3-[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-[(E)-2-phenylethenyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]propyl]-3-fluorobenzoic acid |
| SMILES | CCNC(=O)Nc1ncnc2c1ncn2C1CC(CCCc2c(F)cccc2C(=O)O)C2O[C@H](/C=C/c3ccccc3)OC21 |
| InChI | InChI=1S/C32H33FN6O5/c1-2-34-32(42)38-29-26-30(36-17-35-29)39(18-37-26)24-16-20(10-6-11-21-22(31(40)41)12-7-13-23(21)33)27-28(24)44-25(43-27)15-14-19-8-4-3-5-9-19/h3-5,7-9,12-15,17-18,20,24-25,27-28H,2,6,10-11,16H2,1H3,(H,40,41)(H2,34,35,36,38,42)/b15-14+/t20?,24?,25-,27?,28?/m0/s1 |
| InChIKey | XUZSXJUYTFGNDC-KJNIARBTSA-N |
| XLogP | 5.21 |
| TPSA | 140.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.65 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |