C16H24O4 — CID 59659244
3-[(1R,3S)-3-phenylmethoxycyclohexyl]oxypropane-1,2-diol (PubChem CID 59659244) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is 3-[(1R,3S)-3-phenylmethoxycyclohexyl]oxypropane-1,2-diol.
| Compound Name | 3-[(1R,3S)-3-phenylmethoxycyclohexyl]oxypropane-1,2-diol |
|---|---|
| PubChem CID | 59659244 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 3-[(1R,3S)-3-phenylmethoxycyclohexyl]oxypropane-1,2-diol |
| SMILES | OCC(O)CO[C@@H]1CCC[C@H](OCc2ccccc2)C1 |
| InChI | InChI=1S/C16H24O4/c17-10-14(18)12-20-16-8-4-7-15(9-16)19-11-13-5-2-1-3-6-13/h1-3,5-6,14-18H,4,7-12H2/t14?,15-,16+/m0/s1 |
| InChIKey | IKGIOPLEUHSJBC-MERJSTESSA-N |
| XLogP | 1.88 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |