C14H32O10P2 — CID 59659544
(5,8-dihydroxy-2,11-dimethyl-11-phosphonooxydodecan-2-yl) dihydrogen phosphate (PubChem CID 59659544) has the molecular formula C14H32O10P2 and a molecular weight of 422.35 g/mol. Its IUPAC name is (5,8-dihydroxy-2,11-dimethyl-11-phosphonooxydodecan-2-yl) dihydrogen phosphate.
| Compound Name | (5,8-dihydroxy-2,11-dimethyl-11-phosphonooxydodecan-2-yl) dihydrogen phosphate |
|---|---|
| PubChem CID | 59659544 |
| Molecular Formula | C14H32O10P2 |
| Molecular Weight | 422.35 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | (5,8-dihydroxy-2,11-dimethyl-11-phosphonooxydodecan-2-yl) dihydrogen phosphate |
| SMILES | CC(C)(CCC(O)CCC(O)CCC(C)(C)OP(=O)(O)O)OP(=O)(O)O |
| InChI | InChI=1S/C14H32O10P2/c1-13(2,23-25(17,18)19)9-7-11(15)5-6-12(16)8-10-14(3,4)24-26(20,21)22/h11-12,15-16H,5-10H2,1-4H3,(H2,17,18,19)(H2,20,21,22) |
| InChIKey | IMMJRQMCSACEGA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 173.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.35 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|