About 3-[3,7-dihydroxy-9-(2-oxooxan-3-yl)nonyl]oxan-2-one
3-[3,7-dihydroxy-9-(2-oxooxan-3-yl)nonyl]oxan-2-one (PubChem CID 59659579) has the molecular formula C19H32O6
and a molecular weight of 356.46 g/mol. Its IUPAC name is 3-[3,7-dihydroxy-9-(2-oxooxan-3-yl)nonyl]oxan-2-one.
Molecular Properties
| Compound Name | 3-[3,7-dihydroxy-9-(2-oxooxan-3-yl)nonyl]oxan-2-one |
| PubChem CID | 59659579 |
| Molecular Formula | C19H32O6 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 3-[3,7-dihydroxy-9-(2-oxooxan-3-yl)nonyl]oxan-2-one |
| SMILES | O=C1OCCCC1CCC(O)CCCC(O)CCC1CCCOC1=O |
| InChI | InChI=1S/C19H32O6/c20-16(10-8-14-4-2-12-24-18(14)22)6-1-7-17(21)11-9-15-5-3-13-25-19(15)23/h14-17,20-21H,1-13H2 |
| InChIKey | IFIOOYHWUCRSLK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[3,7-dihydroxy-9-(2-oxooxan-3-yl)nonyl]oxan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,7-dihydroxy-9-(2-oxooxan-3-yl)nonyl]oxan-2-one?
The IUPAC name of 3-[3,7-dihydroxy-9-(2-oxooxan-3-yl)nonyl]oxan-2-one (CID 59659579) is 3-[3,7-dihydroxy-9-(2-oxooxan-3-yl)nonyl]oxan-2-one.
What is the SMILES notation for 3-[3,7-dihydroxy-9-(2-oxooxan-3-yl)nonyl]oxan-2-one?
The canonical SMILES for 3-[3,7-dihydroxy-9-(2-oxooxan-3-yl)nonyl]oxan-2-one is O=C1OCCCC1CCC(O)CCCC(O)CCC1CCCOC1=O.
What is the InChIKey of 3-[3,7-dihydroxy-9-(2-oxooxan-3-yl)nonyl]oxan-2-one?
The InChIKey is IFIOOYHWUCRSLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32O6/c20-16(10-8-14-4-2-12-24-18(14)22)6-1-7-17(21)11-9-15-5-3-13-25-19(15)23/h14-17,20-21H,1-13H2.
What are the key properties of 3-[3,7-dihydroxy-9-(2-oxooxan-3-yl)nonyl]oxan-2-one?
3-[3,7-dihydroxy-9-(2-oxooxan-3-yl)nonyl]oxan-2-one has a molecular weight of 356.46 g/mol, XLogP of 2.35, 10 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,7-dihydroxy-9-(2-oxooxan-3-yl)nonyl]oxan-2-one is sourced from PubChem (CID 59659579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).