About 5-methyl-3-methylidene-2,4-dihydropyrrole
5-methyl-3-methylidene-2,4-dihydropyrrole (PubChem CID 59659995) has the molecular formula C6H9N
and a molecular weight of 95.14 g/mol. Its IUPAC name is 5-methyl-3-methylidene-2,4-dihydropyrrole.
Molecular Properties
| Compound Name | 5-methyl-3-methylidene-2,4-dihydropyrrole |
| PubChem CID | 59659995 |
| Molecular Formula | C6H9N |
| Molecular Weight | 95.14 g/mol |
| Exact Mass | 95.07 |
| IUPAC Name | 5-methyl-3-methylidene-2,4-dihydropyrrole |
| SMILES | C=C1CN=C(C)C1 |
| InChI | InChI=1S/C6H9N/c1-5-3-6(2)7-4-5/h1,3-4H2,2H3 |
| InChIKey | JHSMISIPJPWFOE-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 95.14 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-3-methylidene-2,4-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3-methylidene-2,4-dihydropyrrole?
The IUPAC name of 5-methyl-3-methylidene-2,4-dihydropyrrole (CID 59659995) is 5-methyl-3-methylidene-2,4-dihydropyrrole.
What is the SMILES notation for 5-methyl-3-methylidene-2,4-dihydropyrrole?
The canonical SMILES for 5-methyl-3-methylidene-2,4-dihydropyrrole is C=C1CN=C(C)C1.
What is the InChIKey of 5-methyl-3-methylidene-2,4-dihydropyrrole?
The InChIKey is JHSMISIPJPWFOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N/c1-5-3-6(2)7-4-5/h1,3-4H2,2H3.
What are the key properties of 5-methyl-3-methylidene-2,4-dihydropyrrole?
5-methyl-3-methylidene-2,4-dihydropyrrole has a molecular weight of 95.14 g/mol, XLogP of 1.41, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3-methylidene-2,4-dihydropyrrole is sourced from PubChem (CID 59659995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).