C58H44O8S2+2 — CID 59660043
4-[2-[9-oxo-10-(4-phenylphenyl)thioxanthen-10-ium-2-yl]oxyacetyl]oxybutyl 2-[9-oxo-10-(4-phenylphenyl)thioxanthen-10-ium-2-yl]oxyacetate (PubChem CID 59660043) has the molecular formula C58H44O8S2+2 and a molecular weight of 933.12 g/mol. Its IUPAC name is 4-[2-[9-oxo-10-(4-phenylphenyl)thioxanthen-10-ium-2-yl]oxyacetyl]oxybutyl 2-[9-oxo-10-(4-phenylphenyl)thioxanthen-10-ium-2-yl]oxyacetate.
| Compound Name | 4-[2-[9-oxo-10-(4-phenylphenyl)thioxanthen-10-ium-2-yl]oxyacetyl]oxybutyl 2-[9-oxo-10-(4-phenylphenyl)thioxanthen-10-ium-2-yl]oxyacetate |
|---|---|
| PubChem CID | 59660043 |
| Molecular Formula | C58H44O8S2+2 |
| Molecular Weight | 933.12 g/mol |
| Exact Mass | 932.25 |
| IUPAC Name | 4-[2-[9-oxo-10-(4-phenylphenyl)thioxanthen-10-ium-2-yl]oxyacetyl]oxybutyl 2-[9-oxo-10-(4-phenylphenyl)thioxanthen-10-ium-2-yl]oxyacetate |
| SMILES | O=C(COc1ccc2c(c1)c(=O)c1ccccc1[s+]2-c1ccc(-c2ccccc2)cc1)OCCCCOC(=O)COc1ccc2c(c1)c(=O)c1ccccc1[s+]2-c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C58H44O8S2/c59-55(37-65-43-25-31-53-49(35-43)57(61)47-17-7-9-19-51(47)67(53)45-27-21-41(22-28-45)39-13-3-1-4-14-39)63-33-11-12-34-64-56(60)38-66-44-26-32-54-50(36-44)58(62)48-18-8-10-20-52(48)68(54)46-29-23-42(24-30-46)40-15-5-2-6-16-40/h1-10,13-32,35-36H,11-12,33-34,37-38H2/q+2 |
| InChIKey | GENGXNKKBMCGQN-UHFFFAOYSA-N |
| XLogP | 13.15 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 933.12 |
| LogP ≤ 5 | 13.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|