About 2-cyclohexa-1,3-dien-1-yloxy-5-fluorocyclohexa-1,5-dien-1-amine
2-cyclohexa-1,3-dien-1-yloxy-5-fluorocyclohexa-1,5-dien-1-amine (PubChem CID 59660255) has the molecular formula C12H14FNO
and a molecular weight of 207.25 g/mol. Its IUPAC name is 2-cyclohexa-1,3-dien-1-yloxy-5-fluorocyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | 2-cyclohexa-1,3-dien-1-yloxy-5-fluorocyclohexa-1,5-dien-1-amine |
| PubChem CID | 59660255 |
| Molecular Formula | C12H14FNO |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 2-cyclohexa-1,3-dien-1-yloxy-5-fluorocyclohexa-1,5-dien-1-amine |
| SMILES | NC1=C(OC2=CC=CCC2)CCC(F)=C1 |
| InChI | InChI=1S/C12H14FNO/c13-9-6-7-12(11(14)8-9)15-10-4-2-1-3-5-10/h1-2,4,8H,3,5-7,14H2 |
| InChIKey | ZBJGGEUBWFMXMN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclohexa-1,3-dien-1-yloxy-5-fluorocyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexa-1,3-dien-1-yloxy-5-fluorocyclohexa-1,5-dien-1-amine?
The IUPAC name of 2-cyclohexa-1,3-dien-1-yloxy-5-fluorocyclohexa-1,5-dien-1-amine (CID 59660255) is 2-cyclohexa-1,3-dien-1-yloxy-5-fluorocyclohexa-1,5-dien-1-amine.
What is the SMILES notation for 2-cyclohexa-1,3-dien-1-yloxy-5-fluorocyclohexa-1,5-dien-1-amine?
The canonical SMILES for 2-cyclohexa-1,3-dien-1-yloxy-5-fluorocyclohexa-1,5-dien-1-amine is NC1=C(OC2=CC=CCC2)CCC(F)=C1.
What is the InChIKey of 2-cyclohexa-1,3-dien-1-yloxy-5-fluorocyclohexa-1,5-dien-1-amine?
The InChIKey is ZBJGGEUBWFMXMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14FNO/c13-9-6-7-12(11(14)8-9)15-10-4-2-1-3-5-10/h1-2,4,8H,3,5-7,14H2.
What are the key properties of 2-cyclohexa-1,3-dien-1-yloxy-5-fluorocyclohexa-1,5-dien-1-amine?
2-cyclohexa-1,3-dien-1-yloxy-5-fluorocyclohexa-1,5-dien-1-amine has a molecular weight of 207.25 g/mol, XLogP of 3.05, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexa-1,3-dien-1-yloxy-5-fluorocyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 59660255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).