C30H62O6 — CID 59660292
1,2,3,4,5,6-hexakis[(2-methylpropan-2-yl)oxy]hexane (PubChem CID 59660292) has the molecular formula C30H62O6 and a molecular weight of 518.82 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexakis[(2-methylpropan-2-yl)oxy]hexane.
| Compound Name | 1,2,3,4,5,6-hexakis[(2-methylpropan-2-yl)oxy]hexane |
|---|---|
| PubChem CID | 59660292 |
| Molecular Formula | C30H62O6 |
| Molecular Weight | 518.82 g/mol |
| Exact Mass | 518.45 |
| IUPAC Name | 1,2,3,4,5,6-hexakis[(2-methylpropan-2-yl)oxy]hexane |
| SMILES | CC(C)(C)OCC(OC(C)(C)C)C(OC(C)(C)C)C(OC(C)(C)C)C(COC(C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C30H62O6/c1-25(2,3)31-19-21(33-27(7,8)9)23(35-29(13,14)15)24(36-30(16,17)18)22(34-28(10,11)12)20-32-26(4,5)6/h21-24H,19-20H2,1-18H3 |
| InChIKey | YXYGCJQCWWVLHU-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.82 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |