C11H18F2O3S — CID 59660383
2-(7,7-dimethyl-2-bicyclo[2.2.1]heptanyl)-1,1-difluoroethanesulfonic acid (PubChem CID 59660383) has the molecular formula C11H18F2O3S and a molecular weight of 268.32 g/mol. Its IUPAC name is 2-(7,7-dimethyl-2-bicyclo[2.2.1]heptanyl)-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-(7,7-dimethyl-2-bicyclo[2.2.1]heptanyl)-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 59660383 |
| Molecular Formula | C11H18F2O3S |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 2-(7,7-dimethyl-2-bicyclo[2.2.1]heptanyl)-1,1-difluoroethanesulfonic acid |
| SMILES | CC1(C)C2CCC1C(CC(F)(F)S(=O)(=O)O)C2 |
| InChI | InChI=1S/C11H18F2O3S/c1-10(2)8-3-4-9(10)7(5-8)6-11(12,13)17(14,15)16/h7-9H,3-6H2,1-2H3,(H,14,15,16) |
| InChIKey | JBYCUPXWTIRXLS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|