C11H17F2O3S- — CID 59660390
1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl(difluoro)methanesulfonate (PubChem CID 59660390) has the molecular formula C11H17F2O3S- and a molecular weight of 267.32 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl(difluoro)methanesulfonate.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl(difluoro)methanesulfonate |
|---|---|
| PubChem CID | 59660390 |
| Molecular Formula | C11H17F2O3S- |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl(difluoro)methanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C1CCCC2CCCCC21 |
| InChI | InChI=1S/C11H18F2O3S/c12-11(13,17(14,15)16)10-7-3-5-8-4-1-2-6-9(8)10/h8-10H,1-7H2,(H,14,15,16)/p-1 |
| InChIKey | TZPABSSKJAGZBI-UHFFFAOYSA-M |
| XLogP | 2.73 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|