C21H36 — CID 59660448
1,2,3,4,4,5,6,6,7,8,9,9-dodecamethylbicyclo[3.3.1]nona-2,7-diene (PubChem CID 59660448) has the molecular formula C21H36 and a molecular weight of 288.52 g/mol. Its IUPAC name is 1,2,3,4,4,5,6,6,7,8,9,9-dodecamethylbicyclo[3.3.1]nona-2,7-diene.
| Compound Name | 1,2,3,4,4,5,6,6,7,8,9,9-dodecamethylbicyclo[3.3.1]nona-2,7-diene |
|---|---|
| PubChem CID | 59660448 |
| Molecular Formula | C21H36 |
| Molecular Weight | 288.52 g/mol |
| Exact Mass | 288.28 |
| IUPAC Name | 1,2,3,4,4,5,6,6,7,8,9,9-dodecamethylbicyclo[3.3.1]nona-2,7-diene |
| SMILES | CC1=C(C)C2(C)C(C)=C(C)C(C)(C)C(C)(C1(C)C)C2(C)C |
| InChI | InChI=1S/C21H36/c1-13-15(3)20(11)16(4)14(2)18(7,8)21(12,17(13,5)6)19(20,9)10/h1-12H3 |
| InChIKey | SQPMKFPCYSHETA-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.52 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|