C24H23NO13S3 — CID 59660499
3-[2-[8-sulfo-3,6-bis(trioxidanylsulfanyl)pyren-1-yl]oxyethoxyamino]cyclopentane-1-carboxylic acid (PubChem CID 59660499) has the molecular formula C24H23NO13S3 and a molecular weight of 629.64 g/mol. Its IUPAC name is 3-[2-[8-sulfo-3,6-bis(trioxidanylsulfanyl)pyren-1-yl]oxyethoxyamino]cyclopentane-1-carboxylic acid.
| Compound Name | 3-[2-[8-sulfo-3,6-bis(trioxidanylsulfanyl)pyren-1-yl]oxyethoxyamino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 59660499 |
| Molecular Formula | C24H23NO13S3 |
| Molecular Weight | 629.64 g/mol |
| Exact Mass | 629.03 |
| IUPAC Name | 3-[2-[8-sulfo-3,6-bis(trioxidanylsulfanyl)pyren-1-yl]oxyethoxyamino]cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(NOCCOc2cc(SOOO)c3ccc4c(SOOO)cc(S(=O)(=O)O)c5ccc2c3c45)C1 |
| InChI | InChI=1S/C24H23NO13S3/c26-24(27)12-1-2-13(9-12)25-34-8-7-33-18-10-19(39-37-35-28)15-4-5-16-20(40-38-36-29)11-21(41(30,31)32)17-6-3-14(18)22(15)23(16)17/h3-6,10-13,25,28-29H,1-2,7-9H2,(H,26,27)(H,30,31,32) |
| InChIKey | TWSFKHZQYALUNF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 199.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.64 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|