C64H84N2O5 — CID 59660973
2-[2-[5-methyl-2-[(7-methyl-9,9-dioctylfluoren-2-yl)methyl]-4-octoxyphenoxy]ethyl]-6-morpholin-4-ylbenzo[de]isoquinoline-1,3-dione (PubChem CID 59660973) has the molecular formula C64H84N2O5 and a molecular weight of 961.38 g/mol. Its IUPAC name is 2-[2-[5-methyl-2-[(7-methyl-9,9-dioctylfluoren-2-yl)methyl]-4-octoxyphenoxy]ethyl]-6-morpholin-4-ylbenzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[2-[5-methyl-2-[(7-methyl-9,9-dioctylfluoren-2-yl)methyl]-4-octoxyphenoxy]ethyl]-6-morpholin-4-ylbenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 59660973 |
| Molecular Formula | C64H84N2O5 |
| Molecular Weight | 961.38 g/mol |
| Exact Mass | 960.64 |
| IUPAC Name | 2-[2-[5-methyl-2-[(7-methyl-9,9-dioctylfluoren-2-yl)methyl]-4-octoxyphenoxy]ethyl]-6-morpholin-4-ylbenzo[de]isoquinoline-1,3-dione |
| SMILES | CCCCCCCCOc1cc(Cc2ccc3c(c2)C(CCCCCCCC)(CCCCCCCC)c2cc(C)ccc2-3)c(OCCN2C(=O)c3cccc4c(N5CCOCC5)ccc(c34)C2=O)cc1C |
| InChI | InChI=1S/C64H84N2O5/c1-6-9-12-15-18-21-33-64(34-22-19-16-13-10-7-2)56-42-47(4)27-29-51(56)52-30-28-49(45-57(52)64)44-50-46-59(70-38-23-20-17-14-11-8-3)48(5)43-60(50)71-41-37-66-62(67)54-26-24-25-53-58(65-35-39-69-40-36-65)32-31-55(61(53)54)63(66)68/h24-32,42-43,45-46H,6-23,33-41,44H2,1-5H3 |
| InChIKey | QHYJQYOUUWJBEB-UHFFFAOYSA-N |
| XLogP | 16.07 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 961.38 |
| LogP ≤ 5 | 16.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|