C33H23N5S — CID 59661018
6-(1-benzothiophen-2-yl)-N-phenyl-N-[1-(4-pyrazin-2-ylphenyl)pyrrol-3-yl]pyridin-2-amine (PubChem CID 59661018) has the molecular formula C33H23N5S and a molecular weight of 521.65 g/mol. Its IUPAC name is 6-(1-benzothiophen-2-yl)-N-phenyl-N-[1-(4-pyrazin-2-ylphenyl)pyrrol-3-yl]pyridin-2-amine.
| Compound Name | 6-(1-benzothiophen-2-yl)-N-phenyl-N-[1-(4-pyrazin-2-ylphenyl)pyrrol-3-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 59661018 |
| Molecular Formula | C33H23N5S |
| Molecular Weight | 521.65 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | 6-(1-benzothiophen-2-yl)-N-phenyl-N-[1-(4-pyrazin-2-ylphenyl)pyrrol-3-yl]pyridin-2-amine |
| SMILES | c1ccc(N(c2ccn(-c3ccc(-c4cnccn4)cc3)c2)c2cccc(-c3cc4ccccc4s3)n2)cc1 |
| InChI | InChI=1S/C33H23N5S/c1-2-8-27(9-3-1)38(33-12-6-10-29(36-33)32-21-25-7-4-5-11-31(25)39-32)28-17-20-37(23-28)26-15-13-24(14-16-26)30-22-34-18-19-35-30/h1-23H |
| InChIKey | VHMCTQULZVYSEI-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.65 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |