C22H38F12O6Si2 — CID 59661322
(3,3,4,4,5,5,6,6,7,7,8,8-dodecafluoro-10-triethoxysilyldecyl)-triethoxysilane (PubChem CID 59661322) has the molecular formula C22H38F12O6Si2 and a molecular weight of 682.69 g/mol. Its IUPAC name is (3,3,4,4,5,5,6,6,7,7,8,8-dodecafluoro-10-triethoxysilyldecyl)-triethoxysilane.
| Compound Name | (3,3,4,4,5,5,6,6,7,7,8,8-dodecafluoro-10-triethoxysilyldecyl)-triethoxysilane |
|---|---|
| PubChem CID | 59661322 |
| Molecular Formula | C22H38F12O6Si2 |
| Molecular Weight | 682.69 g/mol |
| Exact Mass | 682.20 |
| IUPAC Name | (3,3,4,4,5,5,6,6,7,7,8,8-dodecafluoro-10-triethoxysilyldecyl)-triethoxysilane |
| SMILES | CCO[Si](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC[Si](OCC)(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C22H38F12O6Si2/c1-7-35-41(36-8-2,37-9-3)15-13-17(23,24)19(27,28)21(31,32)22(33,34)20(29,30)18(25,26)14-16-42(38-10-4,39-11-5)40-12-6/h7-16H2,1-6H3 |
| InChIKey | RAKWPDFAVDYUOM-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.69 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|