C17H32F8O6Si2 — CID 59661327
triethoxy-(3,3,4,4,5,5,6,6-octafluoro-8-trimethoxysilyloctyl)silane (PubChem CID 59661327) has the molecular formula C17H32F8O6Si2 and a molecular weight of 540.59 g/mol. Its IUPAC name is triethoxy-(3,3,4,4,5,5,6,6-octafluoro-8-trimethoxysilyloctyl)silane.
| Compound Name | triethoxy-(3,3,4,4,5,5,6,6-octafluoro-8-trimethoxysilyloctyl)silane |
|---|---|
| PubChem CID | 59661327 |
| Molecular Formula | C17H32F8O6Si2 |
| Molecular Weight | 540.59 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | triethoxy-(3,3,4,4,5,5,6,6-octafluoro-8-trimethoxysilyloctyl)silane |
| SMILES | CCO[Si](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)CC[Si](OC)(OC)OC)(OCC)OCC |
| InChI | InChI=1S/C17H32F8O6Si2/c1-7-29-33(30-8-2,31-9-3)13-11-15(20,21)17(24,25)16(22,23)14(18,19)10-12-32(26-4,27-5)28-6/h7-13H2,1-6H3 |
| InChIKey | LESQNLKATADAKR-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.59 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|