About bis(4-(2-methoxybenzene-6-id-1-yl)-1-methylimidazole);platinum(2+)
bis(4-(2-methoxybenzene-6-id-1-yl)-1-methylimidazole);platinum(2+) (PubChem CID 59661433) has the molecular formula C22H22N4O2Pt
and a molecular weight of 569.52 g/mol. Its IUPAC name is bis(4-(2-methoxybenzene-6-id-1-yl)-1-methylimidazole);platinum(2+).
Molecular Properties
| Compound Name | bis(4-(2-methoxybenzene-6-id-1-yl)-1-methylimidazole);platinum(2+) |
| PubChem CID | 59661433 |
| Molecular Formula | C22H22N4O2Pt |
| Molecular Weight | 569.52 g/mol |
| Exact Mass | 569.14 |
| IUPAC Name | bis(4-(2-methoxybenzene-6-id-1-yl)-1-methylimidazole);platinum(2+) |
| SMILES | COc1ccc[c-]c1-c1cn(C)cn1.COc1ccc[c-]c1-c1cn(C)cn1.[Pt+2] |
| InChI | InChI=1S/2C11H11N2O.Pt/c2*1-13-7-10(12-8-13)9-5-3-4-6-11(9)14-2;/h2*3-4,6-8H,1-2H3;/q2*-1;+2 |
| InChIKey | ZZICVJAIRLVFRF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 54.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 569.52 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze bis(4-(2-methoxybenzene-6-id-1-yl)-1-methylimidazole);platinum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-(2-methoxybenzene-6-id-1-yl)-1-methylimidazole);platinum(2+)?
The IUPAC name of bis(4-(2-methoxybenzene-6-id-1-yl)-1-methylimidazole);platinum(2+) (CID 59661433) is bis(4-(2-methoxybenzene-6-id-1-yl)-1-methylimidazole);platinum(2+).
What is the SMILES notation for bis(4-(2-methoxybenzene-6-id-1-yl)-1-methylimidazole);platinum(2+)?
The canonical SMILES for bis(4-(2-methoxybenzene-6-id-1-yl)-1-methylimidazole);platinum(2+) is COc1ccc[c-]c1-c1cn(C)cn1.COc1ccc[c-]c1-c1cn(C)cn1.[Pt+2].
What is the InChIKey of bis(4-(2-methoxybenzene-6-id-1-yl)-1-methylimidazole);platinum(2+)?
The InChIKey is ZZICVJAIRLVFRF-UHFFFAOYSA-N. The full InChI is InChI=1S/2C11H11N2O.Pt/c2*1-13-7-10(12-8-13)9-5-3-4-6-11(9)14-2;/h2*3-4,6-8H,1-2H3;/q2*-1;+2.
What are the key properties of bis(4-(2-methoxybenzene-6-id-1-yl)-1-methylimidazole);platinum(2+)?
bis(4-(2-methoxybenzene-6-id-1-yl)-1-methylimidazole);platinum(2+) has a molecular weight of 569.52 g/mol, XLogP of 3.79, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-(2-methoxybenzene-6-id-1-yl)-1-methylimidazole);platinum(2+) is sourced from PubChem (CID 59661433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).