C50H26F6N2Pt — CID 59661527
platinum(2+);bis(7-(trifluoromethyl)spiro[9H-indeno[1,2-b]pyridin-9-ide-5,9'-fluorene]) (PubChem CID 59661527) has the molecular formula C50H26F6N2Pt and a molecular weight of 963.84 g/mol. Its IUPAC name is platinum(2+);bis(7-(trifluoromethyl)spiro[9H-indeno[1,2-b]pyridin-9-ide-5,9'-fluorene]).
| Compound Name | platinum(2+);bis(7-(trifluoromethyl)spiro[9H-indeno[1,2-b]pyridin-9-ide-5,9'-fluorene]) |
|---|---|
| PubChem CID | 59661527 |
| Molecular Formula | C50H26F6N2Pt |
| Molecular Weight | 963.84 g/mol |
| Exact Mass | 963.16 |
| IUPAC Name | platinum(2+);bis(7-(trifluoromethyl)spiro[9H-indeno[1,2-b]pyridin-9-ide-5,9'-fluorene]) |
| SMILES | FC(F)(F)c1c[c-]c2c(c1)C1(c3ccccc3-c3ccccc31)c1cccnc1-2.FC(F)(F)c1c[c-]c2c(c1)C1(c3ccccc3-c3ccccc31)c1cccnc1-2.[Pt+2] |
| InChI | InChI=1S/2C25H13F3N.Pt/c2*26-25(27,28)15-11-12-18-22(14-15)24(21-10-5-13-29-23(18)21)19-8-3-1-6-16(19)17-7-2-4-9-20(17)24;/h2*1-11,13-14H;/q2*-1;+2 |
| InChIKey | BBTSYBCXNFRFAG-UHFFFAOYSA-N |
| XLogP | 12.49 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 963.84 |
| LogP ≤ 5 | 12.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|