C31H34BN — CID 59661615
5-(2,4-dimethyl-3-propan-2-ylpentan-3-yl)-7-naphthalen-1-yl-[1]benzoborolo[3,2-b]pyridine (PubChem CID 59661615) has the molecular formula C31H34BN and a molecular weight of 431.43 g/mol. Its IUPAC name is 5-(2,4-dimethyl-3-propan-2-ylpentan-3-yl)-7-naphthalen-1-yl-[1]benzoborolo[3,2-b]pyridine.
| Compound Name | 5-(2,4-dimethyl-3-propan-2-ylpentan-3-yl)-7-naphthalen-1-yl-[1]benzoborolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 59661615 |
| Molecular Formula | C31H34BN |
| Molecular Weight | 431.43 g/mol |
| Exact Mass | 431.28 |
| IUPAC Name | 5-(2,4-dimethyl-3-propan-2-ylpentan-3-yl)-7-naphthalen-1-yl-[1]benzoborolo[3,2-b]pyridine |
| SMILES | CC(C)C(B1c2cc(-c3cccc4ccccc34)ccc2-c2ncccc21)(C(C)C)C(C)C |
| InChI | InChI=1S/C31H34BN/c1-20(2)31(21(3)4,22(5)6)32-28-15-10-18-33-30(28)27-17-16-24(19-29(27)32)26-14-9-12-23-11-7-8-13-25(23)26/h7-22H,1-6H3 |
| InChIKey | SJQVCSZNZPNHHN-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.43 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|