C34H28IrNO2S3- — CID 59661656
2-[2,4-bis(phenylsulfanyl)benzene-6-id-1-yl]-4-phenylsulfanylpyridine;(Z)-4-hydroxypent-3-en-2-one;iridium (PubChem CID 59661656) has the molecular formula C34H28IrNO2S3- and a molecular weight of 771.02 g/mol. Its IUPAC name is 2-[2,4-bis(phenylsulfanyl)benzene-6-id-1-yl]-4-phenylsulfanylpyridine;(Z)-4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 2-[2,4-bis(phenylsulfanyl)benzene-6-id-1-yl]-4-phenylsulfanylpyridine;(Z)-4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 59661656 |
| Molecular Formula | C34H28IrNO2S3- |
| Molecular Weight | 771.02 g/mol |
| Exact Mass | 771.09 |
| IUPAC Name | 2-[2,4-bis(phenylsulfanyl)benzene-6-id-1-yl]-4-phenylsulfanylpyridine;(Z)-4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)/C=C(/C)O.[Ir].[c-]1cc(Sc2ccccc2)cc(Sc2ccccc2)c1-c1cc(Sc2ccccc2)ccn1 |
| InChI | InChI=1S/C29H20NS3.C5H8O2.Ir/c1-4-10-22(11-5-1)31-25-16-17-27(29(21-25)33-24-14-8-3-9-15-24)28-20-26(18-19-30-28)32-23-12-6-2-7-13-23;1-4(6)3-5(2)7;/h1-16,18-21H;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | GXRAZYQGQYVQIP-LWFKIUJUSA-N |
| XLogP | 10.04 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.02 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|