C35H44N2O2S — CID 59661733
5-(5,7-ditert-butyl-1,3-benzothiazol-2-yl)-10,12,12,16,16-pentamethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one (PubChem CID 59661733) has the molecular formula C35H44N2O2S and a molecular weight of 556.82 g/mol. Its IUPAC name is 5-(5,7-ditert-butyl-1,3-benzothiazol-2-yl)-10,12,12,16,16-pentamethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one.
| Compound Name | 5-(5,7-ditert-butyl-1,3-benzothiazol-2-yl)-10,12,12,16,16-pentamethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one |
|---|---|
| PubChem CID | 59661733 |
| Molecular Formula | C35H44N2O2S |
| Molecular Weight | 556.82 g/mol |
| Exact Mass | 556.31 |
| IUPAC Name | 5-(5,7-ditert-butyl-1,3-benzothiazol-2-yl)-10,12,12,16,16-pentamethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one |
| SMILES | CC1CC(C)(C)N2CCC(C)(C)c3c2c1cc1cc(-c2nc4cc(C(C)(C)C)cc(C(C)(C)C)c4s2)c(=O)oc31 |
| InChI | InChI=1S/C35H44N2O2S/c1-19-18-35(10,11)37-13-12-34(8,9)26-27(37)22(19)14-20-15-23(31(38)39-28(20)26)30-36-25-17-21(32(2,3)4)16-24(29(25)40-30)33(5,6)7/h14-17,19H,12-13,18H2,1-11H3 |
| InChIKey | KSYHNTWTHAUNOV-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.82 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|