C72H20O6 — CID 59661748
2,2-bis(docosa-2,4,6,8,10,12,14,16,18,20-decaynoyloxymethyl)butyl docosa-2,4,6,8,10,12,14,16,18,20-decaynoate (PubChem CID 59661748) has the molecular formula C72H20O6 and a molecular weight of 980.95 g/mol. Its IUPAC name is 2,2-bis(docosa-2,4,6,8,10,12,14,16,18,20-decaynoyloxymethyl)butyl docosa-2,4,6,8,10,12,14,16,18,20-decaynoate.
| Compound Name | 2,2-bis(docosa-2,4,6,8,10,12,14,16,18,20-decaynoyloxymethyl)butyl docosa-2,4,6,8,10,12,14,16,18,20-decaynoate |
|---|---|
| PubChem CID | 59661748 |
| Molecular Formula | C72H20O6 |
| Molecular Weight | 980.95 g/mol |
| Exact Mass | 980.13 |
| IUPAC Name | 2,2-bis(docosa-2,4,6,8,10,12,14,16,18,20-decaynoyloxymethyl)butyl docosa-2,4,6,8,10,12,14,16,18,20-decaynoate |
| SMILES | CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC(=O)OCC(CC)(COC(=O)C#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC)COC(=O)C#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC |
| InChI | InChI=1S/C72H20O6/c1-5-9-12-15-18-21-24-27-30-33-36-39-42-45-48-51-54-57-60-63-69(73)76-66-72(8-4,67-77-70(74)64-61-58-55-52-49-46-43-40-37-34-31-28-25-22-19-16-13-10-6-2)68-78-71(75)65-62-59-56-53-50-47-44-41-38-35-32-29-26-23-20-17-14-11-7-3/h8,66-68H2,1-4H3 |
| InChIKey | IYBLUZKHZQQSLM-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 78 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 980.95 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|