C19H27N5O4 — CID 59662964
N-[3-[(4-amino-5,8-dideuterio-6,7-dimethoxyquinazolin-2-yl)-methylamino]-1,1,2,2,3,3-hexadeuteriopropyl]-2-deuteriooxolane-2-carboxamide (PubChem CID 59662964) has the molecular formula C19H27N5O4 and a molecular weight of 398.51 g/mol. Its IUPAC name is N-[3-[(4-amino-5,8-dideuterio-6,7-dimethoxyquinazolin-2-yl)-methylamino]-1,1,2,2,3,3-hexadeuteriopropyl]-2-deuteriooxolane-2-carboxamide.
| Compound Name | N-[3-[(4-amino-5,8-dideuterio-6,7-dimethoxyquinazolin-2-yl)-methylamino]-1,1,2,2,3,3-hexadeuteriopropyl]-2-deuteriooxolane-2-carboxamide |
|---|---|
| PubChem CID | 59662964 |
| Molecular Formula | C19H27N5O4 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | N-[3-[(4-amino-5,8-dideuterio-6,7-dimethoxyquinazolin-2-yl)-methylamino]-1,1,2,2,3,3-hexadeuteriopropyl]-2-deuteriooxolane-2-carboxamide |
| SMILES | [2H]c1c(OC)c(OC)c([2H])c2c(N)nc(N(C)C([2H])([2H])C([2H])([2H])C([2H])([2H])NC(=O)C3([2H])CCCO3)nc12 |
| InChI | InChI=1S/C19H27N5O4/c1-24(8-5-7-21-18(25)14-6-4-9-28-14)19-22-13-11-16(27-3)15(26-2)10-12(13)17(20)23-19/h10-11,14H,4-9H2,1-3H3,(H,21,25)(H2,20,22,23)/i5D2,7D2,8D2,10D,11D,14D |
| InChIKey | WNMJYKCGWZFFKR-OELPGQADSA-N |
| XLogP | 1.35 |
| TPSA | 111.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |