C27H38N6O3 — CID 59663121
tert-butyl N-[[4-[(1-cyclohexylpyrazolo[3,4-d]pyrimidin-6-yl)amino]phenyl]methyl]-N-(3-methoxypropyl)carbamate (PubChem CID 59663121) has the molecular formula C27H38N6O3 and a molecular weight of 494.64 g/mol. Its IUPAC name is tert-butyl N-[[4-[(1-cyclohexylpyrazolo[3,4-d]pyrimidin-6-yl)amino]phenyl]methyl]-N-(3-methoxypropyl)carbamate.
| Compound Name | tert-butyl N-[[4-[(1-cyclohexylpyrazolo[3,4-d]pyrimidin-6-yl)amino]phenyl]methyl]-N-(3-methoxypropyl)carbamate |
|---|---|
| PubChem CID | 59663121 |
| Molecular Formula | C27H38N6O3 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.30 |
| IUPAC Name | tert-butyl N-[[4-[(1-cyclohexylpyrazolo[3,4-d]pyrimidin-6-yl)amino]phenyl]methyl]-N-(3-methoxypropyl)carbamate |
| SMILES | COCCCN(Cc1ccc(Nc2ncc3cnn(C4CCCCC4)c3n2)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H38N6O3/c1-27(2,3)36-26(34)32(15-8-16-35-4)19-20-11-13-22(14-12-20)30-25-28-17-21-18-29-33(24(21)31-25)23-9-6-5-7-10-23/h11-14,17-18,23H,5-10,15-16,19H2,1-4H3,(H,28,30,31) |
| InChIKey | FMRZMXRCQUCJNX-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|