About [2-(3,4-dimethoxyphenyl)-2-oxoethyl] thiocyanate
[2-(3,4-dimethoxyphenyl)-2-oxoethyl] thiocyanate (PubChem CID 596635) has the molecular formula C11H11NO3S
and a molecular weight of 237.28 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-2-oxoethyl] thiocyanate.
Molecular Properties
| Compound Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] thiocyanate |
| PubChem CID | 596635 |
| Molecular Formula | C11H11NO3S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] thiocyanate |
| SMILES | COc1ccc(C(=O)CSC#N)cc1OC |
| InChI | InChI=1S/C11H11NO3S/c1-14-10-4-3-8(5-11(10)15-2)9(13)6-16-7-12/h3-5H,6H2,1-2H3 |
| InChIKey | WAIJFLLFDYMRFP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze [2-(3,4-dimethoxyphenyl)-2-oxoethyl] thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3,4-dimethoxyphenyl)-2-oxoethyl] thiocyanate?
The IUPAC name of [2-(3,4-dimethoxyphenyl)-2-oxoethyl] thiocyanate (CID 596635) is [2-(3,4-dimethoxyphenyl)-2-oxoethyl] thiocyanate.
What is the SMILES notation for [2-(3,4-dimethoxyphenyl)-2-oxoethyl] thiocyanate?
The canonical SMILES for [2-(3,4-dimethoxyphenyl)-2-oxoethyl] thiocyanate is COc1ccc(C(=O)CSC#N)cc1OC.
What is the InChIKey of [2-(3,4-dimethoxyphenyl)-2-oxoethyl] thiocyanate?
The InChIKey is WAIJFLLFDYMRFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO3S/c1-14-10-4-3-8(5-11(10)15-2)9(13)6-16-7-12/h3-5H,6H2,1-2H3.
What are the key properties of [2-(3,4-dimethoxyphenyl)-2-oxoethyl] thiocyanate?
[2-(3,4-dimethoxyphenyl)-2-oxoethyl] thiocyanate has a molecular weight of 237.28 g/mol, XLogP of 2.10, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,4-dimethoxyphenyl)-2-oxoethyl] thiocyanate is sourced from PubChem (CID 596635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).