C15H17NO — CID 59663848
(7S,8S)-8-phenyl-4a,5,6,7,8,8a-hexahydroquinolin-7-ol (PubChem CID 59663848) has the molecular formula C15H17NO and a molecular weight of 227.31 g/mol. Its IUPAC name is (7S,8S)-8-phenyl-4a,5,6,7,8,8a-hexahydroquinolin-7-ol.
| Compound Name | (7S,8S)-8-phenyl-4a,5,6,7,8,8a-hexahydroquinolin-7-ol |
|---|---|
| PubChem CID | 59663848 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | (7S,8S)-8-phenyl-4a,5,6,7,8,8a-hexahydroquinolin-7-ol |
| SMILES | O[C@H]1CCC2C=CC=NC2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C15H17NO/c17-13-9-8-12-7-4-10-16-15(12)14(13)11-5-2-1-3-6-11/h1-7,10,12-15,17H,8-9H2/t12?,13-,14+,15?/m0/s1 |
| InChIKey | OCVIFRAMTJDYDT-RAFNIBEQSA-N |
| XLogP | 2.55 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |