About (3-ethyl-2,5-dimethylphenyl)methanol
(3-ethyl-2,5-dimethylphenyl)methanol (PubChem CID 59663906) has the molecular formula C11H16O
and a molecular weight of 164.25 g/mol. Its IUPAC name is (3-ethyl-2,5-dimethylphenyl)methanol.
Molecular Properties
| Compound Name | (3-ethyl-2,5-dimethylphenyl)methanol |
| PubChem CID | 59663906 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | (3-ethyl-2,5-dimethylphenyl)methanol |
| SMILES | CCc1cc(C)cc(CO)c1C |
| InChI | InChI=1S/C11H16O/c1-4-10-5-8(2)6-11(7-12)9(10)3/h5-6,12H,4,7H2,1-3H3 |
| InChIKey | AMLUCBRPQAGRCP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3-ethyl-2,5-dimethylphenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethyl-2,5-dimethylphenyl)methanol?
The IUPAC name of (3-ethyl-2,5-dimethylphenyl)methanol (CID 59663906) is (3-ethyl-2,5-dimethylphenyl)methanol.
What is the SMILES notation for (3-ethyl-2,5-dimethylphenyl)methanol?
The canonical SMILES for (3-ethyl-2,5-dimethylphenyl)methanol is CCc1cc(C)cc(CO)c1C.
What is the InChIKey of (3-ethyl-2,5-dimethylphenyl)methanol?
The InChIKey is AMLUCBRPQAGRCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O/c1-4-10-5-8(2)6-11(7-12)9(10)3/h5-6,12H,4,7H2,1-3H3.
What are the key properties of (3-ethyl-2,5-dimethylphenyl)methanol?
(3-ethyl-2,5-dimethylphenyl)methanol has a molecular weight of 164.25 g/mol, XLogP of 2.36, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethyl-2,5-dimethylphenyl)methanol is sourced from PubChem (CID 59663906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).