C19H21F5O2S — CID 59664281
3,4-dibutoxy-2-methyl-5-(2,3,4,5,6-pentafluorophenyl)thiophene (PubChem CID 59664281) has the molecular formula C19H21F5O2S and a molecular weight of 408.43 g/mol. Its IUPAC name is 3,4-dibutoxy-2-methyl-5-(2,3,4,5,6-pentafluorophenyl)thiophene.
| Compound Name | 3,4-dibutoxy-2-methyl-5-(2,3,4,5,6-pentafluorophenyl)thiophene |
|---|---|
| PubChem CID | 59664281 |
| Molecular Formula | C19H21F5O2S |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 3,4-dibutoxy-2-methyl-5-(2,3,4,5,6-pentafluorophenyl)thiophene |
| SMILES | CCCCOc1c(C)sc(-c2c(F)c(F)c(F)c(F)c2F)c1OCCCC |
| InChI | InChI=1S/C19H21F5O2S/c1-4-6-8-25-17-10(3)27-19(18(17)26-9-7-5-2)11-12(20)14(22)16(24)15(23)13(11)21/h4-9H2,1-3H3 |
| InChIKey | IWJCQFKOJNMYEW-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|