C12H17N7O8S3 — CID 59664362
3-[[4-amino-6-[2-(methanesulfonamido)ethylamino]-1,3,5-triazin-2-yl]amino]-4-sulfinooxybenzenesulfonic acid (PubChem CID 59664362) has the molecular formula C12H17N7O8S3 and a molecular weight of 483.51 g/mol. Its IUPAC name is 3-[[4-amino-6-[2-(methanesulfonamido)ethylamino]-1,3,5-triazin-2-yl]amino]-4-sulfinooxybenzenesulfonic acid.
| Compound Name | 3-[[4-amino-6-[2-(methanesulfonamido)ethylamino]-1,3,5-triazin-2-yl]amino]-4-sulfinooxybenzenesulfonic acid |
|---|---|
| PubChem CID | 59664362 |
| Molecular Formula | C12H17N7O8S3 |
| Molecular Weight | 483.51 g/mol |
| Exact Mass | 483.03 |
| IUPAC Name | 3-[[4-amino-6-[2-(methanesulfonamido)ethylamino]-1,3,5-triazin-2-yl]amino]-4-sulfinooxybenzenesulfonic acid |
| SMILES | CS(=O)(=O)NCCNc1nc(N)nc(Nc2cc(S(=O)(=O)O)ccc2OS(=O)O)n1 |
| InChI | InChI=1S/C12H17N7O8S3/c1-29(22,23)15-5-4-14-11-17-10(13)18-12(19-11)16-8-6-7(30(24,25)26)2-3-9(8)27-28(20)21/h2-3,6,15H,4-5H2,1H3,(H,20,21)(H,24,25,26)(H4,13,14,16,17,18,19) |
| InChIKey | GFPFNKJSEVUQQL-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 235.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.51 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|